C25H20FN3O5 — CID 46642922
4-[(1,3-dioxoisoindol-2-yl)methyl]-N'-[2-(2-fluorophenoxy)propanoyl]benzohydrazide (PubChem CID 46642922) has the molecular formula C25H20FN3O5 and a molecular weight of 461.45 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]-N'-[2-(2-fluorophenoxy)propanoyl]benzohydrazide.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N'-[2-(2-fluorophenoxy)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 46642922 |
| Molecular Formula | C25H20FN3O5 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N'-[2-(2-fluorophenoxy)propanoyl]benzohydrazide |
| SMILES | CC(Oc1ccccc1F)C(=O)NNC(=O)c1ccc(CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H20FN3O5/c1-15(34-21-9-5-4-8-20(21)26)22(30)27-28-23(31)17-12-10-16(11-13-17)14-29-24(32)18-6-2-3-7-19(18)25(29)33/h2-13,15H,14H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | BVSKCPHDXKFJBI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|