C30H29NO6 — CID 2377046
[2-(4-tert-butylanilino)-2-oxoethyl] 4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzoate (PubChem CID 2377046) has the molecular formula C30H29NO6 and a molecular weight of 499.56 g/mol. Its IUPAC name is [2-(4-tert-butylanilino)-2-oxoethyl] 4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzoate.
| Compound Name | [2-(4-tert-butylanilino)-2-oxoethyl] 4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 2377046 |
| Molecular Formula | C30H29NO6 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | [2-(4-tert-butylanilino)-2-oxoethyl] 4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzoate |
| SMILES | Cc1cc(=O)oc2cc(OCc3ccc(C(=O)OCC(=O)Nc4ccc(C(C)(C)C)cc4)cc3)ccc12 |
| InChI | InChI=1S/C30H29NO6/c1-19-15-28(33)37-26-16-24(13-14-25(19)26)35-17-20-5-7-21(8-6-20)29(34)36-18-27(32)31-23-11-9-22(10-12-23)30(2,3)4/h5-16H,17-18H2,1-4H3,(H,31,32) |
| InChIKey | DVIVJKGMXFIYFX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|