C29H26N4O5 — CID 2443889
1-ethyl-2-methyl-N'-[4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzoyl]benzimidazole-5-carbohydrazide (PubChem CID 2443889) has the molecular formula C29H26N4O5 and a molecular weight of 510.55 g/mol. Its IUPAC name is 1-ethyl-2-methyl-N'-[4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzoyl]benzimidazole-5-carbohydrazide.
| Compound Name | 1-ethyl-2-methyl-N'-[4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzoyl]benzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2443889 |
| Molecular Formula | C29H26N4O5 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 1-ethyl-2-methyl-N'-[4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzoyl]benzimidazole-5-carbohydrazide |
| SMILES | CCn1c(C)nc2cc(C(=O)NNC(=O)c3ccc(COc4ccc5c(C)cc(=O)oc5c4)cc3)ccc21 |
| InChI | InChI=1S/C29H26N4O5/c1-4-33-18(3)30-24-14-21(9-12-25(24)33)29(36)32-31-28(35)20-7-5-19(6-8-20)16-37-22-10-11-23-17(2)13-27(34)38-26(23)15-22/h5-15H,4,16H2,1-3H3,(H,31,35)(H,32,36) |
| InChIKey | IHJLJERZVOICPE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|