C27H26N4O5 — CID 24538873
1-ethyl-3-methyl-2-oxo-N'-[2-(4-phenylmethoxyphenoxy)acetyl]quinoxaline-6-carbohydrazide (PubChem CID 24538873) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2-oxo-N'-[2-(4-phenylmethoxyphenoxy)acetyl]quinoxaline-6-carbohydrazide.
| Compound Name | 1-ethyl-3-methyl-2-oxo-N'-[2-(4-phenylmethoxyphenoxy)acetyl]quinoxaline-6-carbohydrazide |
|---|---|
| PubChem CID | 24538873 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 1-ethyl-3-methyl-2-oxo-N'-[2-(4-phenylmethoxyphenoxy)acetyl]quinoxaline-6-carbohydrazide |
| SMILES | CCn1c(=O)c(C)nc2cc(C(=O)NNC(=O)COc3ccc(OCc4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C27H26N4O5/c1-3-31-24-14-9-20(15-23(24)28-18(2)27(31)34)26(33)30-29-25(32)17-36-22-12-10-21(11-13-22)35-16-19-7-5-4-6-8-19/h4-15H,3,16-17H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | ZUDGHJCTKIYTAI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|