C22H24N4O3S — CID 24517373
1-ethyl-3-methyl-2-oxo-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)quinoxaline-6-carbohydrazide (PubChem CID 24517373) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2-oxo-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)quinoxaline-6-carbohydrazide.
| Compound Name | 1-ethyl-3-methyl-2-oxo-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)quinoxaline-6-carbohydrazide |
|---|---|
| PubChem CID | 24517373 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 1-ethyl-3-methyl-2-oxo-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)quinoxaline-6-carbohydrazide |
| SMILES | CCn1c(=O)c(C)nc2cc(C(=O)NNC(=O)c3cc4c(s3)CCCCC4)ccc21 |
| InChI | InChI=1S/C22H24N4O3S/c1-3-26-17-10-9-15(11-16(17)23-13(2)22(26)29)20(27)24-25-21(28)19-12-14-7-5-4-6-8-18(14)30-19/h9-12H,3-8H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | JIYBHWSIFCFBHX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|