C24H21N3O4 — CID 7518959
[2-(naphthalen-2-ylamino)-2-oxoethyl] 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate (PubChem CID 7518959) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate.
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 7518959 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate |
| SMILES | CCn1c(=O)c(C)nc2cc(C(=O)OCC(=O)Nc3ccc4ccccc4c3)ccc21 |
| InChI | InChI=1S/C24H21N3O4/c1-3-27-21-11-9-18(13-20(21)25-15(2)23(27)29)24(30)31-14-22(28)26-19-10-8-16-6-4-5-7-17(16)12-19/h4-13H,3,14H2,1-2H3,(H,26,28) |
| InChIKey | SBXGIDNUQZMARL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |