C22H22N2O5 — CID 7991043
[2-(4-ethoxyphenyl)-2-oxoethyl] 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate (PubChem CID 7991043) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 7991043 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate |
| SMILES | CCOc1ccc(C(=O)COC(=O)c2ccc3c(c2)nc(C)c(=O)n3CC)cc1 |
| InChI | InChI=1S/C22H22N2O5/c1-4-24-19-11-8-16(12-18(19)23-14(3)21(24)26)22(27)29-13-20(25)15-6-9-17(10-7-15)28-5-2/h6-12H,4-5,13H2,1-3H3 |
| InChIKey | UVDBMOBBWHBKKN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |