C16H18N2O4 — CID 46819421
3-oxobutan-2-yl 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate (PubChem CID 46819421) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-oxobutan-2-yl 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate.
| Compound Name | 3-oxobutan-2-yl 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 46819421 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3-oxobutan-2-yl 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate |
| SMILES | CCn1c(=O)c(C)nc2cc(C(=O)OC(C)C(C)=O)ccc21 |
| InChI | InChI=1S/C16H18N2O4/c1-5-18-14-7-6-12(16(21)22-11(4)10(3)19)8-13(14)17-9(2)15(18)20/h6-8,11H,5H2,1-4H3 |
| InChIKey | NDUZNUUVUFVZEJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |