C22H22N2O4 — CID 8673807
[(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate (PubChem CID 8673807) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate.
| Compound Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 8673807 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate |
| SMILES | CCn1c(=O)c(C)nc2cc(C(=O)O[C@@H](C)C(=O)c3ccc(C)cc3)ccc21 |
| InChI | InChI=1S/C22H22N2O4/c1-5-24-19-11-10-17(12-18(19)23-14(3)21(24)26)22(27)28-15(4)20(25)16-8-6-13(2)7-9-16/h6-12,15H,5H2,1-4H3/t15-/m0/s1 |
| InChIKey | UYOQUAMXBNUIHP-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |