C29H28N2O5 — CID 2530045
7-[[4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]methoxy]-4-methylchromen-2-one (PubChem CID 2530045) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is 7-[[4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]methoxy]-4-methylchromen-2-one.
| Compound Name | 7-[[4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 2530045 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 7-[[4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]methoxy]-4-methylchromen-2-one |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc(COc4ccc5c(C)cc(=O)oc5c4)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H28N2O5/c1-20-17-28(32)36-27-18-25(11-12-26(20)27)35-19-21-3-5-22(6-4-21)29(33)31-15-13-30(14-16-31)23-7-9-24(34-2)10-8-23/h3-12,17-18H,13-16,19H2,1-2H3 |
| InChIKey | SMZSEWPFZGCQAY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|