C26H28N2O4 — CID 97341297
7-[[4-[(3aR,7aS)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carbonyl]phenyl]methoxy]-4-methylchromen-2-one (PubChem CID 97341297) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 7-[[4-[(3aR,7aS)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carbonyl]phenyl]methoxy]-4-methylchromen-2-one.
| Compound Name | 7-[[4-[(3aR,7aS)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carbonyl]phenyl]methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 97341297 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 7-[[4-[(3aR,7aS)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carbonyl]phenyl]methoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCc3ccc(C(=O)N4CC[C@H]5CCN(C)C[C@H]54)cc3)ccc12 |
| InChI | InChI=1S/C26H28N2O4/c1-17-13-25(29)32-24-14-21(7-8-22(17)24)31-16-18-3-5-20(6-4-18)26(30)28-12-10-19-9-11-27(2)15-23(19)28/h3-8,13-14,19,23H,9-12,15-16H2,1-2H3/t19-,23-/m1/s1 |
| InChIKey | PHHBXESXRAPPAS-AUSIDOKSSA-N |
| XLogP | 3.85 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|