C21H16ClN3O5 — CID 29131878
N-[(3-chlorophenyl)methyl]-3-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 29131878) has the molecular formula C21H16ClN3O5 and a molecular weight of 425.83 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-3-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-3-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 29131878 |
| Molecular Formula | C21H16ClN3O5 |
| Molecular Weight | 425.83 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-3-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(OCc3noc(C(=O)NCc4cccc(Cl)c4)n3)ccc12 |
| InChI | InChI=1S/C21H16ClN3O5/c1-12-7-19(26)29-17-9-15(5-6-16(12)17)28-11-18-24-21(30-25-18)20(27)23-10-13-3-2-4-14(22)8-13/h2-9H,10-11H2,1H3,(H,23,27) |
| InChIKey | LSEJUQONGPIAMY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.83 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|