C20H19ClN2O4 — CID 11947976
N-(2-aminoethyl)-2-[7-[(3-chlorophenyl)methoxy]-2-oxochromen-4-yl]acetamide (PubChem CID 11947976) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[7-[(3-chlorophenyl)methoxy]-2-oxochromen-4-yl]acetamide.
| Compound Name | N-(2-aminoethyl)-2-[7-[(3-chlorophenyl)methoxy]-2-oxochromen-4-yl]acetamide |
|---|---|
| PubChem CID | 11947976 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-(2-aminoethyl)-2-[7-[(3-chlorophenyl)methoxy]-2-oxochromen-4-yl]acetamide |
| SMILES | NCCNC(=O)Cc1cc(=O)oc2cc(OCc3cccc(Cl)c3)ccc12 |
| InChI | InChI=1S/C20H19ClN2O4/c21-15-3-1-2-13(8-15)12-26-16-4-5-17-14(9-19(24)23-7-6-22)10-20(25)27-18(17)11-16/h1-5,8,10-11H,6-7,9,12,22H2,(H,23,24) |
| InChIKey | IRLYTHFEAAIEGX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|