C20H18FNO4 — CID 11948020
2-[7-[(3-fluorophenyl)methoxy]-2-oxochromen-4-yl]-N,N-dimethylacetamide (PubChem CID 11948020) has the molecular formula C20H18FNO4 and a molecular weight of 355.37 g/mol. Its IUPAC name is 2-[7-[(3-fluorophenyl)methoxy]-2-oxochromen-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[7-[(3-fluorophenyl)methoxy]-2-oxochromen-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 11948020 |
| Molecular Formula | C20H18FNO4 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-[7-[(3-fluorophenyl)methoxy]-2-oxochromen-4-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1cc(=O)oc2cc(OCc3cccc(F)c3)ccc12 |
| InChI | InChI=1S/C20H18FNO4/c1-22(2)19(23)9-14-10-20(24)26-18-11-16(6-7-17(14)18)25-12-13-4-3-5-15(21)8-13/h3-8,10-11H,9,12H2,1-2H3 |
| InChIKey | NAQTXWKNXIOFFO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|