C19H14ClNO3 — CID 118723932
3-[7-[(3-chlorophenyl)methoxy]-2-oxochromen-4-yl]propanenitrile (PubChem CID 118723932) has the molecular formula C19H14ClNO3 and a molecular weight of 339.78 g/mol. Its IUPAC name is 3-[7-[(3-chlorophenyl)methoxy]-2-oxochromen-4-yl]propanenitrile.
| Compound Name | 3-[7-[(3-chlorophenyl)methoxy]-2-oxochromen-4-yl]propanenitrile |
|---|---|
| PubChem CID | 118723932 |
| Molecular Formula | C19H14ClNO3 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 3-[7-[(3-chlorophenyl)methoxy]-2-oxochromen-4-yl]propanenitrile |
| SMILES | N#CCCc1cc(=O)oc2cc(OCc3cccc(Cl)c3)ccc12 |
| InChI | InChI=1S/C19H14ClNO3/c20-15-5-1-3-13(9-15)12-23-16-6-7-17-14(4-2-8-21)10-19(22)24-18(17)11-16/h1,3,5-7,9-11H,2,4,12H2 |
| InChIKey | ZFXBZYPKERBFMA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|