C26H20Cl2O5 — CID 4086247
methyl 3-(4-chlorophenyl)-2-[7-[(4-chlorophenyl)methoxy]-2-oxochromen-4-yl]propanoate (PubChem CID 4086247) has the molecular formula C26H20Cl2O5 and a molecular weight of 483.35 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-2-[7-[(4-chlorophenyl)methoxy]-2-oxochromen-4-yl]propanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-2-[7-[(4-chlorophenyl)methoxy]-2-oxochromen-4-yl]propanoate |
|---|---|
| PubChem CID | 4086247 |
| Molecular Formula | C26H20Cl2O5 |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-2-[7-[(4-chlorophenyl)methoxy]-2-oxochromen-4-yl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(Cl)cc1)c1cc(=O)oc2cc(OCc3ccc(Cl)cc3)ccc12 |
| InChI | InChI=1S/C26H20Cl2O5/c1-31-26(30)23(12-16-2-6-18(27)7-3-16)22-14-25(29)33-24-13-20(10-11-21(22)24)32-15-17-4-8-19(28)9-5-17/h2-11,13-14,23H,12,15H2,1H3 |
| InChIKey | QQFLMSUEHWQWRQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|