C21H17FN2O4 — CID 9353949
7-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-4-propylchromen-2-one (PubChem CID 9353949) has the molecular formula C21H17FN2O4 and a molecular weight of 380.38 g/mol. Its IUPAC name is 7-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-4-propylchromen-2-one.
| Compound Name | 7-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-4-propylchromen-2-one |
|---|---|
| PubChem CID | 9353949 |
| Molecular Formula | C21H17FN2O4 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 7-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-4-propylchromen-2-one |
| SMILES | CCCc1cc(=O)oc2cc(OCc3nc(-c4ccc(F)cc4)no3)ccc12 |
| InChI | InChI=1S/C21H17FN2O4/c1-2-3-14-10-20(25)27-18-11-16(8-9-17(14)18)26-12-19-23-21(24-28-19)13-4-6-15(22)7-5-13/h4-11H,2-3,12H2,1H3 |
| InChIKey | WKFCBWQGEQCUMX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|