C17H20F3NO7 — CID 129100287
7-[[(2R)-1-[(3R)-1,3-dihydroxybutan-2-yl]oxy-1,3-dihydroxypropan-2-yl]amino]-4-(trifluoromethyl)chromen-2-one (PubChem CID 129100287) has the molecular formula C17H20F3NO7 and a molecular weight of 407.34 g/mol. Its IUPAC name is 7-[[(2R)-1-[(3R)-1,3-dihydroxybutan-2-yl]oxy-1,3-dihydroxypropan-2-yl]amino]-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 7-[[(2R)-1-[(3R)-1,3-dihydroxybutan-2-yl]oxy-1,3-dihydroxypropan-2-yl]amino]-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 129100287 |
| Molecular Formula | C17H20F3NO7 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 7-[[(2R)-1-[(3R)-1,3-dihydroxybutan-2-yl]oxy-1,3-dihydroxypropan-2-yl]amino]-4-(trifluoromethyl)chromen-2-one |
| SMILES | C[C@@H](O)C(CO)OC(O)[C@@H](CO)Nc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C17H20F3NO7/c1-8(24)14(7-23)28-16(26)12(6-22)21-9-2-3-10-11(17(18,19)20)5-15(25)27-13(10)4-9/h2-5,8,12,14,16,21-24,26H,6-7H2,1H3/t8-,12-,14?,16?/m1/s1 |
| InChIKey | KUGFLHDURGYFPD-MCOOHVIFSA-N |
| XLogP | 0.66 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|