C19H20F3N3O6 — CID 162538425
[(2S)-6-acetamido-1-oxo-1-[[2-oxo-4-(trifluoromethyl)chromen-7-yl]amino]hexan-2-yl]carbamic acid (PubChem CID 162538425) has the molecular formula C19H20F3N3O6 and a molecular weight of 443.38 g/mol. Its IUPAC name is [(2S)-6-acetamido-1-oxo-1-[[2-oxo-4-(trifluoromethyl)chromen-7-yl]amino]hexan-2-yl]carbamic acid.
| Compound Name | [(2S)-6-acetamido-1-oxo-1-[[2-oxo-4-(trifluoromethyl)chromen-7-yl]amino]hexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 162538425 |
| Molecular Formula | C19H20F3N3O6 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | [(2S)-6-acetamido-1-oxo-1-[[2-oxo-4-(trifluoromethyl)chromen-7-yl]amino]hexan-2-yl]carbamic acid |
| SMILES | CC(=O)NCCCC[C@H](NC(=O)O)C(=O)Nc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H20F3N3O6/c1-10(26)23-7-3-2-4-14(25-18(29)30)17(28)24-11-5-6-12-13(19(20,21)22)9-16(27)31-15(12)8-11/h5-6,8-9,14,25H,2-4,7H2,1H3,(H,23,26)(H,24,28)(H,29,30)/t14-/m0/s1 |
| InChIKey | CHZLGIOISOVUCN-AWEZNQCLSA-N |
| XLogP | 2.69 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|