C17H19F3N4O5 — CID 134137031
4-(diaminomethylideneamino)-N-(4-methyl-2-oxochromen-7-yl)butanamide;2,2,2-trifluoroacetic acid (PubChem CID 134137031) has the molecular formula C17H19F3N4O5 and a molecular weight of 416.36 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)-N-(4-methyl-2-oxochromen-7-yl)butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(diaminomethylideneamino)-N-(4-methyl-2-oxochromen-7-yl)butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 134137031 |
| Molecular Formula | C17H19F3N4O5 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 4-(diaminomethylideneamino)-N-(4-methyl-2-oxochromen-7-yl)butanamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)CCCN=C(N)N)ccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H18N4O3.C2HF3O2/c1-9-7-14(21)22-12-8-10(4-5-11(9)12)19-13(20)3-2-6-18-15(16)17;3-2(4,5)1(6)7/h4-5,7-8H,2-3,6H2,1H3,(H,19,20)(H4,16,17,18);(H,6,7) |
| InChIKey | JVLCIICPKJEIKO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 161.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|