C18H23NO4 — CID 146254066
[(2S)-2,3,3-trimethylbutyl] N-(4-methyl-2-oxochromen-7-yl)carbamate (PubChem CID 146254066) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is [(2S)-2,3,3-trimethylbutyl] N-(4-methyl-2-oxochromen-7-yl)carbamate.
| Compound Name | [(2S)-2,3,3-trimethylbutyl] N-(4-methyl-2-oxochromen-7-yl)carbamate |
|---|---|
| PubChem CID | 146254066 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | [(2S)-2,3,3-trimethylbutyl] N-(4-methyl-2-oxochromen-7-yl)carbamate |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)OC[C@@H](C)C(C)(C)C)ccc12 |
| InChI | InChI=1S/C18H23NO4/c1-11-8-16(20)23-15-9-13(6-7-14(11)15)19-17(21)22-10-12(2)18(3,4)5/h6-9,12H,10H2,1-5H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | GMXWJNZUOQFZBF-GFCCVEGCSA-N |
| XLogP | 4.33 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|