C24H26N2O5 — CID 134137608
tert-butyl N-[4-[3-[(4-methyl-2-oxochromen-7-yl)amino]-3-oxopropyl]phenyl]carbamate (PubChem CID 134137608) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[(4-methyl-2-oxochromen-7-yl)amino]-3-oxopropyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-[(4-methyl-2-oxochromen-7-yl)amino]-3-oxopropyl]phenyl]carbamate |
|---|---|
| PubChem CID | 134137608 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | tert-butyl N-[4-[3-[(4-methyl-2-oxochromen-7-yl)amino]-3-oxopropyl]phenyl]carbamate |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)CCc3ccc(NC(=O)OC(C)(C)C)cc3)ccc12 |
| InChI | InChI=1S/C24H26N2O5/c1-15-13-22(28)30-20-14-18(10-11-19(15)20)25-21(27)12-7-16-5-8-17(9-6-16)26-23(29)31-24(2,3)4/h5-6,8-11,13-14H,7,12H2,1-4H3,(H,25,27)(H,26,29) |
| InChIKey | AKGZAWJJWCRYRJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|