C29H35N3O7 — CID 11478207
benzyl N-[(3S)-1-[(4-methyl-2-oxochromen-7-yl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-3-yl]carbamate (PubChem CID 11478207) has the molecular formula C29H35N3O7 and a molecular weight of 537.61 g/mol. Its IUPAC name is benzyl N-[(3S)-1-[(4-methyl-2-oxochromen-7-yl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-1-[(4-methyl-2-oxochromen-7-yl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 11478207 |
| Molecular Formula | C29H35N3O7 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | benzyl N-[(3S)-1-[(4-methyl-2-oxochromen-7-yl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-3-yl]carbamate |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)C[C@H](CCCNC(=O)OC(C)(C)C)NC(=O)OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C29H35N3O7/c1-19-15-26(34)38-24-16-22(12-13-23(19)24)31-25(33)17-21(11-8-14-30-27(35)39-29(2,3)4)32-28(36)37-18-20-9-6-5-7-10-20/h5-7,9-10,12-13,15-16,21H,8,11,14,17-18H2,1-4H3,(H,30,35)(H,31,33)(H,32,36)/t21-/m0/s1 |
| InChIKey | GVLWYDODJGXPHO-NRFANRHFSA-N |
| XLogP | 5.03 |
| TPSA | 135.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|