C15H15Cl2N3O2S2 — CID 19680524
1-(2,5-dichlorophenyl)-3-[4-(ethylsulfamoyl)phenyl]thiourea (PubChem CID 19680524) has the molecular formula C15H15Cl2N3O2S2 and a molecular weight of 404.34 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[4-(ethylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[4-(ethylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19680524 |
| Molecular Formula | C15H15Cl2N3O2S2 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[4-(ethylsulfamoyl)phenyl]thiourea |
| SMILES | CCNS(=O)(=O)c1ccc(NC(=S)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C15H15Cl2N3O2S2/c1-2-18-24(21,22)12-6-4-11(5-7-12)19-15(23)20-14-9-10(16)3-8-13(14)17/h3-9,18H,2H2,1H3,(H2,19,20,23) |
| InChIKey | BIOKGODDKNAYEQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|