C17H17ClF2N2O3S2 — CID 2211597
methyl 2-[[3-chloro-4-(difluoromethoxy)phenyl]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate (PubChem CID 2211597) has the molecular formula C17H17ClF2N2O3S2 and a molecular weight of 434.92 g/mol. Its IUPAC name is methyl 2-[[3-chloro-4-(difluoromethoxy)phenyl]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[3-chloro-4-(difluoromethoxy)phenyl]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2211597 |
| Molecular Formula | C17H17ClF2N2O3S2 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | methyl 2-[[3-chloro-4-(difluoromethoxy)phenyl]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
| SMILES | CCc1c(C)sc(NC(=S)Nc2ccc(OC(F)F)c(Cl)c2)c1C(=O)OC |
| InChI | InChI=1S/C17H17ClF2N2O3S2/c1-4-10-8(2)27-14(13(10)15(23)24-3)22-17(26)21-9-5-6-12(11(18)7-9)25-16(19)20/h5-7,16H,4H2,1-3H3,(H2,21,22,26) |
| InChIKey | COMYDVCLKXEKAY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|