C16H19NO4S2 — CID 71654905
methyl 4-ethyl-5-methyl-2-[(4-methylphenyl)sulfonylamino]thiophene-3-carboxylate (PubChem CID 71654905) has the molecular formula C16H19NO4S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is methyl 4-ethyl-5-methyl-2-[(4-methylphenyl)sulfonylamino]thiophene-3-carboxylate.
| Compound Name | methyl 4-ethyl-5-methyl-2-[(4-methylphenyl)sulfonylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 71654905 |
| Molecular Formula | C16H19NO4S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | methyl 4-ethyl-5-methyl-2-[(4-methylphenyl)sulfonylamino]thiophene-3-carboxylate |
| SMILES | CCc1c(C)sc(NS(=O)(=O)c2ccc(C)cc2)c1C(=O)OC |
| InChI | InChI=1S/C16H19NO4S2/c1-5-13-11(3)22-15(14(13)16(18)21-4)17-23(19,20)12-8-6-10(2)7-9-12/h6-9,17H,5H2,1-4H3 |
| InChIKey | BSIDKVUCSMGJGY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |