C20H26N2O2S2 — CID 17383562
methyl 2-[(2-tert-butylphenyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate (PubChem CID 17383562) has the molecular formula C20H26N2O2S2 and a molecular weight of 390.57 g/mol. Its IUPAC name is methyl 2-[(2-tert-butylphenyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-tert-butylphenyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17383562 |
| Molecular Formula | C20H26N2O2S2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | methyl 2-[(2-tert-butylphenyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
| SMILES | CCc1c(C)sc(NC(=S)Nc2ccccc2C(C)(C)C)c1C(=O)OC |
| InChI | InChI=1S/C20H26N2O2S2/c1-7-13-12(2)26-17(16(13)18(23)24-6)22-19(25)21-15-11-9-8-10-14(15)20(3,4)5/h8-11H,7H2,1-6H3,(H2,21,22,25) |
| InChIKey | LVCCFUQFVULSGS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|