C21H19NO3S — CID 1014668
methyl 5-ethyl-2-[(4-phenylbenzoyl)amino]thiophene-3-carboxylate (PubChem CID 1014668) has the molecular formula C21H19NO3S and a molecular weight of 365.45 g/mol. Its IUPAC name is methyl 5-ethyl-2-[(4-phenylbenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-ethyl-2-[(4-phenylbenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1014668 |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | methyl 5-ethyl-2-[(4-phenylbenzoyl)amino]thiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(NC(=O)c2ccc(-c3ccccc3)cc2)s1 |
| InChI | InChI=1S/C21H19NO3S/c1-3-17-13-18(21(24)25-2)20(26-17)22-19(23)16-11-9-15(10-12-16)14-7-5-4-6-8-14/h4-13H,3H2,1-2H3,(H,22,23) |
| InChIKey | ULIWPYKONFPRIH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |