C23H22N2O4S — CID 22133061
methyl 4-[[3-(benzylcarbamoyl)-5-ethylthiophen-2-yl]carbamoyl]benzoate (PubChem CID 22133061) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is methyl 4-[[3-(benzylcarbamoyl)-5-ethylthiophen-2-yl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[3-(benzylcarbamoyl)-5-ethylthiophen-2-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 22133061 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | methyl 4-[[3-(benzylcarbamoyl)-5-ethylthiophen-2-yl]carbamoyl]benzoate |
| SMILES | CCc1cc(C(=O)NCc2ccccc2)c(NC(=O)c2ccc(C(=O)OC)cc2)s1 |
| InChI | InChI=1S/C23H22N2O4S/c1-3-18-13-19(21(27)24-14-15-7-5-4-6-8-15)22(30-18)25-20(26)16-9-11-17(12-10-16)23(28)29-2/h4-13H,3,14H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | TVCGIEMFCNAXKB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |