C24H24ClN3O2S2 — CID 19654623
ethyl 2-[[4-(3-chlorophenyl)piperazine-1-carbothioyl]amino]-5-phenylthiophene-3-carboxylate (PubChem CID 19654623) has the molecular formula C24H24ClN3O2S2 and a molecular weight of 486.06 g/mol. Its IUPAC name is ethyl 2-[[4-(3-chlorophenyl)piperazine-1-carbothioyl]amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-(3-chlorophenyl)piperazine-1-carbothioyl]amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19654623 |
| Molecular Formula | C24H24ClN3O2S2 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | ethyl 2-[[4-(3-chlorophenyl)piperazine-1-carbothioyl]amino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=S)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H24ClN3O2S2/c1-2-30-23(29)20-16-21(17-7-4-3-5-8-17)32-22(20)26-24(31)28-13-11-27(12-14-28)19-10-6-9-18(25)15-19/h3-10,15-16H,2,11-14H2,1H3,(H,26,31) |
| InChIKey | RIGQROBCRWFHLW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|