C18H20N2O4S2 — CID 17268138
methyl 2-[1-(1,3-benzodioxol-5-yl)ethylcarbamothioylamino]-5-ethylthiophene-3-carboxylate (PubChem CID 17268138) has the molecular formula C18H20N2O4S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is methyl 2-[1-(1,3-benzodioxol-5-yl)ethylcarbamothioylamino]-5-ethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[1-(1,3-benzodioxol-5-yl)ethylcarbamothioylamino]-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17268138 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | methyl 2-[1-(1,3-benzodioxol-5-yl)ethylcarbamothioylamino]-5-ethylthiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(NC(=S)NC(C)c2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C18H20N2O4S2/c1-4-12-8-13(17(21)22-3)16(26-12)20-18(25)19-10(2)11-5-6-14-15(7-11)24-9-23-14/h5-8,10H,4,9H2,1-3H3,(H2,19,20,25) |
| InChIKey | SNEPRCSWSODEDE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|