C20H28N2O3S2 — CID 66571170
1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-(dithiolan-3-yl)pentan-1-one (PubChem CID 66571170) has the molecular formula C20H28N2O3S2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-(dithiolan-3-yl)pentan-1-one.
| Compound Name | 1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-(dithiolan-3-yl)pentan-1-one |
|---|---|
| PubChem CID | 66571170 |
| Molecular Formula | C20H28N2O3S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-(dithiolan-3-yl)pentan-1-one |
| SMILES | O=C(CCCCC1CCSS1)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H28N2O3S2/c23-20(4-2-1-3-17-7-12-26-27-17)22-10-8-21(9-11-22)14-16-5-6-18-19(13-16)25-15-24-18/h5-6,13,17H,1-4,7-12,14-15H2 |
| InChIKey | CWHSIKNPHGRTJU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|