C35H50N2O3 — CID 71964308
(2R,3R)-3-[(3S)-3-hydroxyoct-1-enyl]-2-[7-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-7-oxoheptyl]cyclopentan-1-one (PubChem CID 71964308) has the molecular formula C35H50N2O3 and a molecular weight of 546.80 g/mol. Its IUPAC name is (2R,3R)-3-[(3S)-3-hydroxyoct-1-enyl]-2-[7-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-7-oxoheptyl]cyclopentan-1-one.
| Compound Name | (2R,3R)-3-[(3S)-3-hydroxyoct-1-enyl]-2-[7-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-7-oxoheptyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 71964308 |
| Molecular Formula | C35H50N2O3 |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.38 |
| IUPAC Name | (2R,3R)-3-[(3S)-3-hydroxyoct-1-enyl]-2-[7-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-7-oxoheptyl]cyclopentan-1-one |
| SMILES | CCCCC[C@H](O)C=C[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)N1CCn2c3c(c4cc(C)ccc42)CCCC31 |
| InChI | InChI=1S/C35H50N2O3/c1-3-4-7-11-27(38)19-17-26-18-21-33(39)28(26)12-8-5-6-9-15-34(40)36-22-23-37-31-20-16-25(2)24-30(31)29-13-10-14-32(36)35(29)37/h16-17,19-20,24,26-28,32,38H,3-15,18,21-23H2,1-2H3/t26-,27-,28+,32?/m0/s1 |
| InChIKey | ISAFZCXFMHVCKN-YXUDPXNJSA-N |
| XLogP | 7.60 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|