C32H50N2O5 — CID 127254074
1-[(1S)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]-7-[(1R,5R)-2-hydroxyimino-5-[(3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptan-1-one (PubChem CID 127254074) has the molecular formula C32H50N2O5 and a molecular weight of 542.76 g/mol. Its IUPAC name is 1-[(1S)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]-7-[(1R,5R)-2-hydroxyimino-5-[(3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptan-1-one.
| Compound Name | 1-[(1S)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]-7-[(1R,5R)-2-hydroxyimino-5-[(3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptan-1-one |
|---|---|
| PubChem CID | 127254074 |
| Molecular Formula | C32H50N2O5 |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.37 |
| IUPAC Name | 1-[(1S)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]-7-[(1R,5R)-2-hydroxyimino-5-[(3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptan-1-one |
| SMILES | CCCCC[C@H](O)C=C[C@H]1CCC(=NO)[C@@H]1CCCCCCC(=O)N1CCc2cc(OC)c(OC)cc2[C@@H]1C |
| InChI | InChI=1S/C32H50N2O5/c1-5-6-9-12-26(35)17-15-24-16-18-29(33-37)27(24)13-10-7-8-11-14-32(36)34-20-19-25-21-30(38-3)31(39-4)22-28(25)23(34)2/h15,17,21-24,26-27,35,37H,5-14,16,18-20H2,1-4H3/t23-,24-,26-,27+/m0/s1 |
| InChIKey | NJLBVNFDQAWROZ-LTMODKEVSA-N |
| XLogP | 6.84 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|