C19H36O5S — CID 57240042
2-[4-[(1R,2R)-3,5-dihydroxy-2-(1-hydroxyoctyl)cyclopentyl]butylsulfanyl]acetic acid (PubChem CID 57240042) has the molecular formula C19H36O5S and a molecular weight of 376.56 g/mol. Its IUPAC name is 2-[4-[(1R,2R)-3,5-dihydroxy-2-(1-hydroxyoctyl)cyclopentyl]butylsulfanyl]acetic acid.
| Compound Name | 2-[4-[(1R,2R)-3,5-dihydroxy-2-(1-hydroxyoctyl)cyclopentyl]butylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 57240042 |
| Molecular Formula | C19H36O5S |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2-[4-[(1R,2R)-3,5-dihydroxy-2-(1-hydroxyoctyl)cyclopentyl]butylsulfanyl]acetic acid |
| SMILES | CCCCCCCC(O)[C@@H]1C(O)CC(O)[C@@H]1CCCCSCC(=O)O |
| InChI | InChI=1S/C19H36O5S/c1-2-3-4-5-6-10-15(20)19-14(16(21)12-17(19)22)9-7-8-11-25-13-18(23)24/h14-17,19-22H,2-13H2,1H3,(H,23,24)/t14-,15?,16?,17?,19+/m0/s1 |
| InChIKey | YYIRTXBVCUITEA-XOYUVUHLSA-N |
| XLogP | 3.05 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|