About dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid)
dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid) (PubChem CID 157292375) has the molecular formula C30H64O4S2Sn
and a molecular weight of 671.68 g/mol. Its IUPAC name is dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid).
Molecular Properties
| Compound Name | dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid) |
| PubChem CID | 157292375 |
| Molecular Formula | C30H64O4S2Sn |
| Molecular Weight | 671.68 g/mol |
| Exact Mass | 672.33 |
| IUPAC Name | dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid) |
| SMILES | CC(C)CCCCCSCC(=O)O.CC(C)CCCCCSCC(=O)O.CCCC[Sn](C)(C)CCCC |
| InChI | InChI=1S/2C10H20O2S.2C4H9.2CH3.Sn/c2*1-9(2)6-4-3-5-7-13-8-10(11)12;2*1-3-4-2;;;/h2*9H,3-8H2,1-2H3,(H,11,12);2*1,3-4H2,2H3;2*1H3; |
| InChIKey | BAYLVOHMSXUPCU-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 671.68 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid)?
The IUPAC name of dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid) (CID 157292375) is dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid).
What is the SMILES notation for dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid)?
The canonical SMILES for dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid) is CC(C)CCCCCSCC(=O)O.CC(C)CCCCCSCC(=O)O.CCCC[Sn](C)(C)CCCC.
What is the InChIKey of dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid)?
The InChIKey is BAYLVOHMSXUPCU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H20O2S.2C4H9.2CH3.Sn/c2*1-9(2)6-4-3-5-7-13-8-10(11)12;2*1-3-4-2;;;/h2*9H,3-8H2,1-2H3,(H,11,12);2*1,3-4H2,2H3;2*1H3;.
What are the key properties of dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid)?
dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid) has a molecular weight of 671.68 g/mol, XLogP of 10.34, 22 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl(dimethyl)stannane;bis(2-(6-methylheptylsulfanyl)acetic acid) is sourced from PubChem (CID 157292375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).