C29H62O2SSn — CID 174166479
dibutyl-bis(7-methyloctyl)stannane;3-sulfanylpropanoic acid (PubChem CID 174166479) has the molecular formula C29H62O2SSn and a molecular weight of 593.59 g/mol. Its IUPAC name is dibutyl-bis(7-methyloctyl)stannane;3-sulfanylpropanoic acid.
| Compound Name | dibutyl-bis(7-methyloctyl)stannane;3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 174166479 |
| Molecular Formula | C29H62O2SSn |
| Molecular Weight | 593.59 g/mol |
| Exact Mass | 594.35 |
| IUPAC Name | dibutyl-bis(7-methyloctyl)stannane;3-sulfanylpropanoic acid |
| SMILES | CCCC[Sn](CCCC)(CCCCCCC(C)C)CCCCCCC(C)C.O=C(O)CCS |
| InChI | InChI=1S/2C9H19.2C4H9.C3H6O2S.Sn/c2*1-4-5-6-7-8-9(2)3;2*1-3-4-2;4-3(5)1-2-6;/h2*9H,1,4-8H2,2-3H3;2*1,3-4H2,2H3;6H,1-2H2,(H,4,5); |
| InChIKey | WPHNCTDPKDYTBA-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.59 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|