C18H36N2O2 — CID 7376375
methyl 2-[(1S,2R,3R)-3-[3-(dimethylamino)propylamino]-2-pentylcyclopentyl]acetate (PubChem CID 7376375) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is methyl 2-[(1S,2R,3R)-3-[3-(dimethylamino)propylamino]-2-pentylcyclopentyl]acetate.
| Compound Name | methyl 2-[(1S,2R,3R)-3-[3-(dimethylamino)propylamino]-2-pentylcyclopentyl]acetate |
|---|---|
| PubChem CID | 7376375 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | methyl 2-[(1S,2R,3R)-3-[3-(dimethylamino)propylamino]-2-pentylcyclopentyl]acetate |
| SMILES | CCCCC[C@@H]1[C@H](CC(=O)OC)CC[C@H]1NCCCN(C)C |
| InChI | InChI=1S/C18H36N2O2/c1-5-6-7-9-16-15(14-18(21)22-4)10-11-17(16)19-12-8-13-20(2)3/h15-17,19H,5-14H2,1-4H3/t15-,16+,17+/m0/s1 |
| InChIKey | DITWSVCWNJUFDK-GVDBMIGSSA-N |
| XLogP | 3.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|