C27H46O5Si — CID 57130343
7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[4-hydroxy-4-(2-trimethylsilylethynyl)dec-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 57130343) has the molecular formula C27H46O5Si and a molecular weight of 478.75 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[4-hydroxy-4-(2-trimethylsilylethynyl)dec-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[4-hydroxy-4-(2-trimethylsilylethynyl)dec-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57130343 |
| Molecular Formula | C27H46O5Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[4-hydroxy-4-(2-trimethylsilylethynyl)dec-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCCC(O)(C#C[Si](C)(C)C)CC=C[C@@H]1[C@@H](CC=CCCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C27H46O5Si/c1-5-6-7-12-17-27(32,19-20-33(2,3)4)18-13-15-23-22(24(28)21-25(23)29)14-10-8-9-11-16-26(30)31/h8,10,13,15,22-25,28-29,32H,5-7,9,11-12,14,16-18,21H2,1-4H3,(H,30,31)/t22-,23-,24+,25-,27?/m1/s1 |
| InChIKey | IDUSDPGAGVAEFO-MLGNGNQOSA-N |
| XLogP | 5.07 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|