C16H25NO5 — CID 88839938
2-[(1R,2S,3R,5S)-2-(3-cyano-3-hydroxyoct-1-enyl)-3,5-dihydroxycyclopentyl]acetic acid (PubChem CID 88839938) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-[(1R,2S,3R,5S)-2-(3-cyano-3-hydroxyoct-1-enyl)-3,5-dihydroxycyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2S,3R,5S)-2-(3-cyano-3-hydroxyoct-1-enyl)-3,5-dihydroxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 88839938 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-[(1R,2S,3R,5S)-2-(3-cyano-3-hydroxyoct-1-enyl)-3,5-dihydroxycyclopentyl]acetic acid |
| SMILES | CCCCCC(O)(C#N)C=C[C@H]1[C@@H](CC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C16H25NO5/c1-2-3-4-6-16(22,10-17)7-5-11-12(8-15(20)21)14(19)9-13(11)18/h5,7,11-14,18-19,22H,2-4,6,8-9H2,1H3,(H,20,21)/t11-,12+,13+,14-,16?/m0/s1 |
| InChIKey | QQJAPWQCBOBNJW-OVIBUNEPSA-N |
| XLogP | 1.21 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|