C25H40O5 — CID 70609850
5-(cyclopenten-1-yl)-6-methyl-9-(oxan-2-yloxy)-3-oxotetradec-7-enoic acid (PubChem CID 70609850) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is 5-(cyclopenten-1-yl)-6-methyl-9-(oxan-2-yloxy)-3-oxotetradec-7-enoic acid.
| Compound Name | 5-(cyclopenten-1-yl)-6-methyl-9-(oxan-2-yloxy)-3-oxotetradec-7-enoic acid |
|---|---|
| PubChem CID | 70609850 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 5-(cyclopenten-1-yl)-6-methyl-9-(oxan-2-yloxy)-3-oxotetradec-7-enoic acid |
| SMILES | CCCCCC(C=CC(C)C(CC(=O)CC(=O)O)C1=CCCC1)OC1CCCCO1 |
| InChI | InChI=1S/C25H40O5/c1-3-4-5-12-22(30-25-13-8-9-16-29-25)15-14-19(2)23(20-10-6-7-11-20)17-21(26)18-24(27)28/h10,14-15,19,22-23,25H,3-9,11-13,16-18H2,1-2H3,(H,27,28) |
| InChIKey | QMYCJOGUOGLWHK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|