C24H39O4P — CID 59075789
(1S,2R,3R,4R)-2-heptyl-3-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-4-tritiophosphanyloxycyclopentan-1-ol (PubChem CID 59075789) has the molecular formula C24H39O4P and a molecular weight of 424.55 g/mol. Its IUPAC name is (1S,2R,3R,4R)-2-heptyl-3-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-4-tritiophosphanyloxycyclopentan-1-ol.
| Compound Name | (1S,2R,3R,4R)-2-heptyl-3-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-4-tritiophosphanyloxycyclopentan-1-ol |
|---|---|
| PubChem CID | 59075789 |
| Molecular Formula | C24H39O4P |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | (1S,2R,3R,4R)-2-heptyl-3-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-4-tritiophosphanyloxycyclopentan-1-ol |
| SMILES | [3H]PO[C@@H]1C[C@H](O)[C@H](CCCCCCC)[C@H]1/C=C/[C@@H](O)Cc1cccc(COC)c1 |
| InChI | InChI=1S/C24H39O4P/c1-3-4-5-6-7-11-21-22(24(28-29)16-23(21)26)13-12-20(25)15-18-9-8-10-19(14-18)17-27-2/h8-10,12-14,20-26H,3-7,11,15-17,29H2,1-2H3/b13-12+/t20-,21-,22-,23+,24-/m1/s1/i29T/t20-,21-,22-,23+,24-,29? |
| InChIKey | POANLQLVYGLTDD-FJDJNTKOSA-N |
| XLogP | 4.83 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|