C23H33ClN2O4S — CID 173220311
O-[[(1S,2R,3S,5R)-2-[7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]methyl] N-[(3-chlorophenyl)methyl]carbamothioate (PubChem CID 173220311) has the molecular formula C23H33ClN2O4S and a molecular weight of 469.05 g/mol. Its IUPAC name is O-[[(1S,2R,3S,5R)-2-[7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]methyl] N-[(3-chlorophenyl)methyl]carbamothioate.
| Compound Name | O-[[(1S,2R,3S,5R)-2-[7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]methyl] N-[(3-chlorophenyl)methyl]carbamothioate |
|---|---|
| PubChem CID | 173220311 |
| Molecular Formula | C23H33ClN2O4S |
| Molecular Weight | 469.05 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | O-[[(1S,2R,3S,5R)-2-[7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]methyl] N-[(3-chlorophenyl)methyl]carbamothioate |
| SMILES | CCNC(=O)CCCC=CC[C@@H]1[C@@H](COC(=S)NCc2cccc(Cl)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H33ClN2O4S/c1-2-25-22(29)11-6-4-3-5-10-18-19(21(28)13-20(18)27)15-30-23(31)26-14-16-8-7-9-17(24)12-16/h3,5,7-9,12,18-21,27-28H,2,4,6,10-11,13-15H2,1H3,(H,25,29)(H,26,31)/t18-,19-,20+,21-/m1/s1 |
| InChIKey | HQCNDENIWUCDAI-MXEMCNAFSA-N |
| XLogP | 3.34 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.05 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|