C17H27BO4 — CID 162267298
CID 162267298 (PubChem CID 162267298) has the molecular formula C17H27BO4 and a molecular weight of 306.21 g/mol.
| Compound Name | CID 162267298 |
|---|---|
| PubChem CID | 162267298 |
| Molecular Formula | C17H27BO4 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | — |
| SMILES | [B]CC(O)=CC[C@H]1[C@H](O)CC(O)[C@@H]1CC=CCCCC(C)=O |
| InChI | InChI=1S/C17H27BO4/c1-12(19)6-4-2-3-5-7-14-15(9-8-13(20)11-18)17(22)10-16(14)21/h3,5,8,14-17,20-22H,2,4,6-7,9-11H2,1H3/t14-,15-,16?,17-/m1/s1 |
| InChIKey | RBCPDKOJPOXCIL-FRBBGCKASA-N |
| XLogP | 2.47 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|