C27H44O5 — CID 165111479
(Z)-8-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylmethoxypentyl]cyclopentyl]oct-6-en-2-one;ethane (PubChem CID 165111479) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is (Z)-8-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylmethoxypentyl]cyclopentyl]oct-6-en-2-one;ethane.
| Compound Name | (Z)-8-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylmethoxypentyl]cyclopentyl]oct-6-en-2-one;ethane |
|---|---|
| PubChem CID | 165111479 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | (Z)-8-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylmethoxypentyl]cyclopentyl]oct-6-en-2-one;ethane |
| SMILES | CC.CC(=O)CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](O)CCOCc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H38O5.C2H6/c1-19(26)9-5-2-3-8-12-22-23(25(29)17-24(22)28)14-13-21(27)15-16-30-18-20-10-6-4-7-11-20;1-2/h3-4,6-8,10-11,21-25,27-29H,2,5,9,12-18H2,1H3;1-2H3/b8-3-;/t21-,22-,23-,24+,25-;/m1./s1 |
| InChIKey | JTWAONSHXNUZTE-ZAKUIKHXSA-N |
| XLogP | 4.82 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|