C20H34F2O5 — CID 131709045
2,2,4,4-tetradeuterio-7-[(1R,2R,3R)-2-(4,4-difluoro-3-hydroxyoctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 131709045) has the molecular formula C20H34F2O5 and a molecular weight of 396.51 g/mol. Its IUPAC name is 2,2,4,4-tetradeuterio-7-[(1R,2R,3R)-2-(4,4-difluoro-3-hydroxyoctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 2,2,4,4-tetradeuterio-7-[(1R,2R,3R)-2-(4,4-difluoro-3-hydroxyoctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 131709045 |
| Molecular Formula | C20H34F2O5 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 2,2,4,4-tetradeuterio-7-[(1R,2R,3R)-2-(4,4-difluoro-3-hydroxyoctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | [2H]C([2H])(CCC[C@H]1C(=O)C[C@@H](O)[C@@H]1CCC(O)C(F)(F)CCCC)CC([2H])([2H])C(=O)O |
| InChI | InChI=1S/C20H34F2O5/c1-2-3-12-20(21,22)18(25)11-10-15-14(16(23)13-17(15)24)8-6-4-5-7-9-19(26)27/h14-15,17-18,24-25H,2-13H2,1H3,(H,26,27)/t14-,15-,17-,18?/m1/s1/i5D2,9D2 |
| InChIKey | PNVYHTHOCKTJCO-FBRQBILGSA-N |
| XLogP | 3.94 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |