C36H50F2O4 — CID 146220720
benzyl 7-[(1R,2R,3R)-2-(3-ethyl-4,4-difluorooctyl)-5-oxo-3-phenylmethoxycyclopentyl]heptanoate (PubChem CID 146220720) has the molecular formula C36H50F2O4 and a molecular weight of 584.79 g/mol. Its IUPAC name is benzyl 7-[(1R,2R,3R)-2-(3-ethyl-4,4-difluorooctyl)-5-oxo-3-phenylmethoxycyclopentyl]heptanoate.
| Compound Name | benzyl 7-[(1R,2R,3R)-2-(3-ethyl-4,4-difluorooctyl)-5-oxo-3-phenylmethoxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 146220720 |
| Molecular Formula | C36H50F2O4 |
| Molecular Weight | 584.79 g/mol |
| Exact Mass | 584.37 |
| IUPAC Name | benzyl 7-[(1R,2R,3R)-2-(3-ethyl-4,4-difluorooctyl)-5-oxo-3-phenylmethoxycyclopentyl]heptanoate |
| SMILES | CCCCC(F)(F)C(CC)CC[C@H]1[C@H](OCc2ccccc2)CC(=O)[C@@H]1CCCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H50F2O4/c1-3-5-24-36(37,38)30(4-2)22-23-32-31(33(39)25-34(32)41-26-28-16-10-8-11-17-28)20-14-6-7-15-21-35(40)42-27-29-18-12-9-13-19-29/h8-13,16-19,30-32,34H,3-7,14-15,20-27H2,1-2H3/t30?,31-,32-,34-/m1/s1 |
| InChIKey | UZDSLKXJDJKSJK-IBTXJGMQSA-N |
| XLogP | 9.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.79 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|