C27H40F2O5 — CID 154951506
benzyl 7-[(2R,4aR,5R,7aR)-2-(1,1-difluoropentyl)-2,6-dihydroxy-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[b]pyran-5-yl]heptanoate (PubChem CID 154951506) has the molecular formula C27H40F2O5 and a molecular weight of 482.61 g/mol. Its IUPAC name is benzyl 7-[(2R,4aR,5R,7aR)-2-(1,1-difluoropentyl)-2,6-dihydroxy-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[b]pyran-5-yl]heptanoate.
| Compound Name | benzyl 7-[(2R,4aR,5R,7aR)-2-(1,1-difluoropentyl)-2,6-dihydroxy-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[b]pyran-5-yl]heptanoate |
|---|---|
| PubChem CID | 154951506 |
| Molecular Formula | C27H40F2O5 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | benzyl 7-[(2R,4aR,5R,7aR)-2-(1,1-difluoropentyl)-2,6-dihydroxy-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[b]pyran-5-yl]heptanoate |
| SMILES | CCCCC(F)(F)[C@@]1(O)CC[C@H]2[C@@H](CC(O)[C@@H]2CCCCCCC(=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C27H40F2O5/c1-2-3-16-26(28,29)27(32)17-15-22-21(23(30)18-24(22)34-27)13-9-4-5-10-14-25(31)33-19-20-11-7-6-8-12-20/h6-8,11-12,21-24,30,32H,2-5,9-10,13-19H2,1H3/t21-,22-,23?,24-,27-/m1/s1 |
| InChIKey | CGBNVUSICZSCLW-PDZITIEESA-N |
| XLogP | 5.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|