C20H30F2O5 — CID 15200557
(Z)-7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooctyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 15200557) has the molecular formula C20H30F2O5 and a molecular weight of 388.45 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooctyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooctyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 15200557 |
| Molecular Formula | C20H30F2O5 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooctyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCC(F)(F)C(=O)CCC[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30F2O5/c1-2-12-20(21,22)18(25)10-7-9-15-14(16(23)13-17(15)24)8-5-3-4-6-11-19(26)27/h3,5,14-15,17,24H,2,4,6-13H2,1H3,(H,26,27)/b5-3-/t14-,15-,17-/m1/s1 |
| InChIKey | AWNHHGCJYFEYRL-WUUWOAEGSA-N |
| XLogP | 3.93 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|