C22H36O4 — CID 54217293
7-[(1S,4R)-4-(4,4-dimethyloctanoyl)-2-oxocyclopentyl]hept-5-enoic acid (PubChem CID 54217293) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is 7-[(1S,4R)-4-(4,4-dimethyloctanoyl)-2-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,4R)-4-(4,4-dimethyloctanoyl)-2-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54217293 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 7-[(1S,4R)-4-(4,4-dimethyloctanoyl)-2-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(C)(C)CCC(=O)[C@H]1CC(=O)[C@@H](CC=CCCCC(=O)O)C1 |
| InChI | InChI=1S/C22H36O4/c1-4-5-13-22(2,3)14-12-19(23)18-15-17(20(24)16-18)10-8-6-7-9-11-21(25)26/h6,8,17-18H,4-5,7,9-16H2,1-3H3,(H,25,26)/t17-,18+/m0/s1 |
| InChIKey | QACJECIMTUQKSS-ZWKOTPCHSA-N |
| XLogP | 5.35 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|